C22H40N4O5S — CID 178035152
2-(2,2-dimethylpropanoylamino)-6-[5-[3-formamido-4-(methylamino)thiolan-2-yl]pentanoylamino]hexanoic acid (PubChem CID 178035152) has the molecular formula C22H40N4O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-6-[5-[3-formamido-4-(methylamino)thiolan-2-yl]pentanoylamino]hexanoic acid.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-6-[5-[3-formamido-4-(methylamino)thiolan-2-yl]pentanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 178035152 |
| Molecular Formula | C22H40N4O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-6-[5-[3-formamido-4-(methylamino)thiolan-2-yl]pentanoylamino]hexanoic acid |
| SMILES | CNC1CSC(CCCCC(=O)NCCCCC(NC(=O)C(C)(C)C)C(=O)O)C1NC=O |
| InChI | InChI=1S/C22H40N4O5S/c1-22(2,3)21(31)26-15(20(29)30)9-7-8-12-24-18(28)11-6-5-10-17-19(25-14-27)16(23-4)13-32-17/h14-17,19,23H,5-13H2,1-4H3,(H,24,28)(H,25,27)(H,26,31)(H,29,30) |
| InChIKey | IVIWNXGNZRVWQJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|