C23H48N2OS — CID 143927444
N-butyl-5-[3-propan-2-yl-4-(prop-1-en-2-ylamino)thiolan-2-yl]pentanamide;ethane (PubChem CID 143927444) has the molecular formula C23H48N2OS and a molecular weight of 400.72 g/mol. Its IUPAC name is N-butyl-5-[3-propan-2-yl-4-(prop-1-en-2-ylamino)thiolan-2-yl]pentanamide;ethane.
| Compound Name | N-butyl-5-[3-propan-2-yl-4-(prop-1-en-2-ylamino)thiolan-2-yl]pentanamide;ethane |
|---|---|
| PubChem CID | 143927444 |
| Molecular Formula | C23H48N2OS |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.35 |
| IUPAC Name | N-butyl-5-[3-propan-2-yl-4-(prop-1-en-2-ylamino)thiolan-2-yl]pentanamide;ethane |
| SMILES | C=C(C)NC1CSC(CCCCC(=O)NCCCC)C1C(C)C.CC.CC |
| InChI | InChI=1S/C19H36N2OS.2C2H6/c1-6-7-12-20-18(22)11-9-8-10-17-19(14(2)3)16(13-23-17)21-15(4)5;2*1-2/h14,16-17,19,21H,4,6-13H2,1-3,5H3,(H,20,22);2*1-2H3 |
| InChIKey | UMACXQJGDZTFGI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|