C10H16N4 — CID 129261943
8-methyl-6,6a,7,9,10,10a-hexahydro-5H-[1,2,4]triazolo[3,4-a][2,6]naphthyridine (PubChem CID 129261943) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 8-methyl-6,6a,7,9,10,10a-hexahydro-5H-[1,2,4]triazolo[3,4-a][2,6]naphthyridine.
| Compound Name | 8-methyl-6,6a,7,9,10,10a-hexahydro-5H-[1,2,4]triazolo[3,4-a][2,6]naphthyridine |
|---|---|
| PubChem CID | 129261943 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 8-methyl-6,6a,7,9,10,10a-hexahydro-5H-[1,2,4]triazolo[3,4-a][2,6]naphthyridine |
| SMILES | CN1CCC2c3nncn3CCC2C1 |
| InChI | InChI=1S/C10H16N4/c1-13-4-3-9-8(6-13)2-5-14-7-11-12-10(9)14/h7-9H,2-6H2,1H3 |
| InChIKey | BVDYRUKMYLQGEY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |