C26H32O7 — CID 129262215
methyl (1'R,2'R,3R,9'S,11'S)-11'-acetyl-11'-hydroxy-2,2,2',6',9'-pentamethyl-12'-methylidene-6,10'-dioxospiro[pyran-3,5'-tricyclo[7.2.1.02,7]dodec-6-ene]-1'-carboxylate (PubChem CID 129262215) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl (1'R,2'R,3R,9'S,11'S)-11'-acetyl-11'-hydroxy-2,2,2',6',9'-pentamethyl-12'-methylidene-6,10'-dioxospiro[pyran-3,5'-tricyclo[7.2.1.02,7]dodec-6-ene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'R,3R,9'S,11'S)-11'-acetyl-11'-hydroxy-2,2,2',6',9'-pentamethyl-12'-methylidene-6,10'-dioxospiro[pyran-3,5'-tricyclo[7.2.1.02,7]dodec-6-ene]-1'-carboxylate |
|---|---|
| PubChem CID | 129262215 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | methyl (1'R,2'R,3R,9'S,11'S)-11'-acetyl-11'-hydroxy-2,2,2',6',9'-pentamethyl-12'-methylidene-6,10'-dioxospiro[pyran-3,5'-tricyclo[7.2.1.02,7]dodec-6-ene]-1'-carboxylate |
| SMILES | C=C1[C@]2(C)CC3=C(C)[C@]4(C=CC(=O)OC4(C)C)CC[C@@]3(C)[C@@]1(C(=O)OC)[C@](O)(C(C)=O)C2=O |
| InChI | InChI=1S/C26H32O7/c1-14-17-13-22(6)15(2)25(20(30)32-8,26(31,16(3)27)19(22)29)23(17,7)11-12-24(14)10-9-18(28)33-21(24,4)5/h9-10,31H,2,11-13H2,1,3-8H3/t22-,23+,24-,25+,26-/m0/s1 |
| InChIKey | YPJSTLFKGDJKQZ-FYQRJBHISA-N |
| XLogP | 3.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|