C18H40NP — CID 129267370
(3R,5S)-4-dimethylphosphanyl-2-ethyl-N,3,5,9-tetramethyldecan-1-amine (PubChem CID 129267370) has the molecular formula C18H40NP and a molecular weight of 301.50 g/mol. Its IUPAC name is (3R,5S)-4-dimethylphosphanyl-2-ethyl-N,3,5,9-tetramethyldecan-1-amine.
| Compound Name | (3R,5S)-4-dimethylphosphanyl-2-ethyl-N,3,5,9-tetramethyldecan-1-amine |
|---|---|
| PubChem CID | 129267370 |
| Molecular Formula | C18H40NP |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.29 |
| IUPAC Name | (3R,5S)-4-dimethylphosphanyl-2-ethyl-N,3,5,9-tetramethyldecan-1-amine |
| SMILES | CCC(CNC)[C@@H](C)C([C@@H](C)CCCC(C)C)P(C)C |
| InChI | InChI=1S/C18H40NP/c1-9-17(13-19-6)16(5)18(20(7)8)15(4)12-10-11-14(2)3/h14-19H,9-13H2,1-8H3/t15-,16+,17?,18?/m0/s1 |
| InChIKey | BISYMYUBCXWJFW-KNXWPPODSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|