C10H12N2OS2 — CID 129269629
2-methyl-1,1-bis(1,3-thiazol-2-yl)propan-1-ol (PubChem CID 129269629) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-methyl-1,1-bis(1,3-thiazol-2-yl)propan-1-ol.
| Compound Name | 2-methyl-1,1-bis(1,3-thiazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 129269629 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-methyl-1,1-bis(1,3-thiazol-2-yl)propan-1-ol |
| SMILES | CC(C)C(O)(c1nccs1)c1nccs1 |
| InChI | InChI=1S/C10H12N2OS2/c1-7(2)10(13,8-11-3-5-14-8)9-12-4-6-15-9/h3-7,13H,1-2H3 |
| InChIKey | VUNDCDUGKWZTCY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |