C13H16ClN3O2 — CID 129271140
6-chloro-2-[1-(oxan-2-yloxy)ethyl]-3H-imidazo[4,5-c]pyridine (PubChem CID 129271140) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6-chloro-2-[1-(oxan-2-yloxy)ethyl]-3H-imidazo[4,5-c]pyridine.
| Compound Name | 6-chloro-2-[1-(oxan-2-yloxy)ethyl]-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 129271140 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 6-chloro-2-[1-(oxan-2-yloxy)ethyl]-3H-imidazo[4,5-c]pyridine |
| SMILES | CC(OC1CCCCO1)c1nc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-8(19-12-4-2-3-5-18-12)13-16-9-6-11(14)15-7-10(9)17-13/h6-8,12H,2-5H2,1H3,(H,16,17) |
| InChIKey | BADQNCZKAYVOIG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|