C21H28N2O7 — CID 129275101
tert-butyl N-[1-[(4,7-dihydroxy-8-methyl-2-oxochromen-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 129275101) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is tert-butyl N-[1-[(4,7-dihydroxy-8-methyl-2-oxochromen-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(4,7-dihydroxy-8-methyl-2-oxochromen-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 129275101 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | tert-butyl N-[1-[(4,7-dihydroxy-8-methyl-2-oxochromen-3-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1c(O)ccc2c(O)c(NC(=O)C(CC(C)C)NC(=O)OC(C)(C)C)c(=O)oc12 |
| InChI | InChI=1S/C21H28N2O7/c1-10(2)9-13(22-20(28)30-21(4,5)6)18(26)23-15-16(25)12-7-8-14(24)11(3)17(12)29-19(15)27/h7-8,10,13,24-25H,9H2,1-6H3,(H,22,28)(H,23,26) |
| InChIKey | FKEXKPBKHDFWJZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|