C11H12FN — CID 129276902
3-ethyl-5-fluoro-2,4-dimethylbenzonitrile (PubChem CID 129276902) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile.
| Compound Name | 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 129276902 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile |
| SMILES | CCc1c(C)c(F)cc(C#N)c1C |
| InChI | InChI=1S/C11H12FN/c1-4-10-7(2)9(6-13)5-11(12)8(10)3/h5H,4H2,1-3H3 |
| InChIKey | HJHKYHVFLPXBMY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |