About 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile
3-ethyl-5-fluoro-2,4-dimethylbenzonitrile (PubChem CID 129276902) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile |
| PubChem CID | 129276902 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile |
| SMILES | CCc1c(C)c(F)cc(C#N)c1C |
| InChI | InChI=1S/C11H12FN/c1-4-10-7(2)9(6-13)5-11(12)8(10)3/h5H,4H2,1-3H3 |
| InChIKey | HJHKYHVFLPXBMY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile?
The IUPAC name of 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile (CID 129276902) is 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile.
What is the SMILES notation for 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile?
The canonical SMILES for 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile is CCc1c(C)c(F)cc(C#N)c1C.
What is the InChIKey of 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile?
The InChIKey is HJHKYHVFLPXBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN/c1-4-10-7(2)9(6-13)5-11(12)8(10)3/h5H,4H2,1-3H3.
What are the key properties of 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile?
3-ethyl-5-fluoro-2,4-dimethylbenzonitrile has a molecular weight of 177.22 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-fluoro-2,4-dimethylbenzonitrile is sourced from PubChem (CID 129276902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).