C22H22F3N3O5 — CID 129283821
N-hydroxy-2-[3-(piperidin-1-ylmethyl)phenyl]-1,3-benzoxazole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 129283821) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is N-hydroxy-2-[3-(piperidin-1-ylmethyl)phenyl]-1,3-benzoxazole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2-[3-(piperidin-1-ylmethyl)phenyl]-1,3-benzoxazole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 129283821 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-hydroxy-2-[3-(piperidin-1-ylmethyl)phenyl]-1,3-benzoxazole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1ccc2oc(-c3cccc(CN4CCCCC4)c3)nc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N3O3.C2HF3O2/c24-19(22-25)15-7-8-18-17(12-15)21-20(26-18)16-6-4-5-14(11-16)13-23-9-2-1-3-10-23;3-2(4,5)1(6)7/h4-8,11-12,25H,1-3,9-10,13H2,(H,22,24);(H,6,7) |
| InChIKey | UJLOCTUQCLBPNB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|