C52H101NO6 — CID 129287902
8-O-[3-[methyl(propan-2-yl)amino]propyl] 1-O,16-O-bis(3-pentyloctyl) hexadecane-1,8,16-tricarboxylate (PubChem CID 129287902) has the molecular formula C52H101NO6 and a molecular weight of 836.38 g/mol. Its IUPAC name is 8-O-[3-[methyl(propan-2-yl)amino]propyl] 1-O,16-O-bis(3-pentyloctyl) hexadecane-1,8,16-tricarboxylate.
| Compound Name | 8-O-[3-[methyl(propan-2-yl)amino]propyl] 1-O,16-O-bis(3-pentyloctyl) hexadecane-1,8,16-tricarboxylate |
|---|---|
| PubChem CID | 129287902 |
| Molecular Formula | C52H101NO6 |
| Molecular Weight | 836.38 g/mol |
| Exact Mass | 835.76 |
| IUPAC Name | 8-O-[3-[methyl(propan-2-yl)amino]propyl] 1-O,16-O-bis(3-pentyloctyl) hexadecane-1,8,16-tricarboxylate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCC(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)C(=O)OCCCN(C)C(C)C |
| InChI | InChI=1S/C52H101NO6/c1-8-12-23-32-47(33-24-13-9-2)40-44-57-50(54)38-29-21-17-16-19-27-36-49(52(56)59-43-31-42-53(7)46(5)6)37-28-20-18-22-30-39-51(55)58-45-41-48(34-25-14-10-3)35-26-15-11-4/h46-49H,8-45H2,1-7H3 |
| InChIKey | WTPWIDPKWQNDTH-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.38 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|