About 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate
1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate (PubChem CID 166970075) has the molecular formula C30H59NO4
and a molecular weight of 497.81 g/mol. Its IUPAC name is 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate.
Molecular Properties
| Compound Name | 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate |
| PubChem CID | 166970075 |
| Molecular Formula | C30H59NO4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.44 |
| IUPAC Name | 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCCC(=O)OCCCN(C)C(C)C |
| InChI | InChI=1S/C30H59NO4/c1-6-8-14-19-28(20-15-9-7-2)23-26-35-30(33)22-17-13-11-10-12-16-21-29(32)34-25-18-24-31(5)27(3)4/h27-28H,6-26H2,1-5H3 |
| InChIKey | BANKGWVGQZUBIZ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate?
The IUPAC name of 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate (CID 166970075) is 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate.
What is the SMILES notation for 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate?
The canonical SMILES for 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate is CCCCCC(CCCCC)CCOC(=O)CCCCCCCCC(=O)OCCCN(C)C(C)C.
What is the InChIKey of 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate?
The InChIKey is BANKGWVGQZUBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H59NO4/c1-6-8-14-19-28(20-15-9-7-2)23-26-35-30(33)22-17-13-11-10-12-16-21-29(32)34-25-18-24-31(5)27(3)4/h27-28H,6-26H2,1-5H3.
What are the key properties of 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate?
1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate has a molecular weight of 497.81 g/mol, XLogP of 8.09, 25 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[3-[methyl(propan-2-yl)amino]propyl] 10-O-(3-pentyloctyl) decanedioate is sourced from PubChem (CID 166970075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).