C43H46N2O6 — CID 129289146
2-[3-[5-(2,5-ditert-butyl-4-hydroxyphenoxy)-1,3-dioxoisoindol-2-yl]phenyl]-5-(3-methylhexan-3-yl)isoindole-1,3-dione (PubChem CID 129289146) has the molecular formula C43H46N2O6 and a molecular weight of 686.85 g/mol. Its IUPAC name is 2-[3-[5-(2,5-ditert-butyl-4-hydroxyphenoxy)-1,3-dioxoisoindol-2-yl]phenyl]-5-(3-methylhexan-3-yl)isoindole-1,3-dione.
| Compound Name | 2-[3-[5-(2,5-ditert-butyl-4-hydroxyphenoxy)-1,3-dioxoisoindol-2-yl]phenyl]-5-(3-methylhexan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 129289146 |
| Molecular Formula | C43H46N2O6 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | 2-[3-[5-(2,5-ditert-butyl-4-hydroxyphenoxy)-1,3-dioxoisoindol-2-yl]phenyl]-5-(3-methylhexan-3-yl)isoindole-1,3-dione |
| SMILES | CCCC(C)(CC)c1ccc2c(c1)C(=O)N(c1cccc(N3C(=O)c4ccc(Oc5cc(C(C)(C)C)c(O)cc5C(C)(C)C)cc4C3=O)c1)C2=O |
| InChI | InChI=1S/C43H46N2O6/c1-10-19-43(9,11-2)25-15-17-29-31(20-25)39(49)44(37(29)47)26-13-12-14-27(21-26)45-38(48)30-18-16-28(22-32(30)40(45)50)51-36-24-33(41(3,4)5)35(46)23-34(36)42(6,7)8/h12-18,20-24,46H,10-11,19H2,1-9H3 |
| InChIKey | NJOKIDNBIDEOIG-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|