C12H23NO2 — CID 129290564
2,2,5-trimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 129290564) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2,5-trimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | 2,2,5-trimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 129290564 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2,5-trimethyl-4-(2-methylpropyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC(C)CC1C2OC(C)(C)OC2CN1C |
| InChI | InChI=1S/C12H23NO2/c1-8(2)6-9-11-10(7-13(9)5)14-12(3,4)15-11/h8-11H,6-7H2,1-5H3 |
| InChIKey | ZEDVEAXVVLRFAS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |