C21H40O4Si — CID 11143497
tri(propan-2-yl)-[(1R,3S,7S,9R)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]silane (PubChem CID 11143497) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is tri(propan-2-yl)-[(1R,3S,7S,9R)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]silane.
| Compound Name | tri(propan-2-yl)-[(1R,3S,7S,9R)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]silane |
|---|---|
| PubChem CID | 11143497 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | tri(propan-2-yl)-[(1R,3S,7S,9R)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-yl]silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C1[C@H]2OC(C)(C)O[C@H]2C[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C21H40O4Si/c1-12(2)26(13(3)4,14(5)6)19-17-15(22-20(7,8)24-17)11-16-18(19)25-21(9,10)23-16/h12-19H,11H2,1-10H3/t15-,16+,17-,18+,19? |
| InChIKey | JESPLRGOACNAIQ-MKAJOQBOSA-N |
| XLogP | 5.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|