C20H23NO5 — CID 12929320
(1-methyl-4-phenyl-4-propanoyloxypiperidin-3-yl) furan-2-carboxylate (PubChem CID 12929320) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1-methyl-4-phenyl-4-propanoyloxypiperidin-3-yl) furan-2-carboxylate.
| Compound Name | (1-methyl-4-phenyl-4-propanoyloxypiperidin-3-yl) furan-2-carboxylate |
|---|---|
| PubChem CID | 12929320 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (1-methyl-4-phenyl-4-propanoyloxypiperidin-3-yl) furan-2-carboxylate |
| SMILES | CCC(=O)OC1(c2ccccc2)CCN(C)CC1OC(=O)c1ccco1 |
| InChI | InChI=1S/C20H23NO5/c1-3-18(22)26-20(15-8-5-4-6-9-15)11-12-21(2)14-17(20)25-19(23)16-10-7-13-24-16/h4-10,13,17H,3,11-12,14H2,1-2H3 |
| InChIKey | XXMNRLZJSZHKMY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |