C38H34N6 — CID 129294382
3-[4-[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]-N,N-bis[(3Z)-penta-1,3-dien-2-yl]aniline (PubChem CID 129294382) has the molecular formula C38H34N6 and a molecular weight of 574.73 g/mol. Its IUPAC name is 3-[4-[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]-N,N-bis[(3Z)-penta-1,3-dien-2-yl]aniline.
| Compound Name | 3-[4-[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]-N,N-bis[(3Z)-penta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 129294382 |
| Molecular Formula | C38H34N6 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 3-[4-[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]-6-quinolin-5-yl-1,3,5-triazin-2-yl]-N,N-bis[(3Z)-penta-1,3-dien-2-yl]aniline |
| SMILES | C=Nc1cccc(-c2nc(-c3cccc(N(C(=C)/C=C\C)C(=C)/C=C\C)c3)nc(-c3cccc4ncccc34)n2)c1/C=C\C |
| InChI | InChI=1S/C38H34N6/c1-7-14-26(4)44(27(5)15-8-2)29-18-10-17-28(25-29)36-41-37(32-19-11-22-34(39-6)30(32)16-9-3)43-38(42-36)33-20-12-23-35-31(33)21-13-24-40-35/h7-25H,4-6H2,1-3H3/b14-7-,15-8-,16-9- |
| InChIKey | DIROKQULVHECSZ-FNGKUAQTSA-N |
| XLogP | 9.77 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|