C30H38O5 — CID 129295239
CID 129295239 (PubChem CID 129295239) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol.
| Compound Name | CID 129295239 |
|---|---|
| PubChem CID | 129295239 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2=CC3(C)C(CCC34OCCO4)C3CC=C4CC5(CCC4(C)C23)OCCO5)cc1 |
| InChI | InChI=1S/C30H38O5/c1-27-12-13-29(32-14-15-33-29)18-21(27)6-9-23-25-10-11-30(34-16-17-35-30)28(25,2)19-24(26(23)27)20-4-7-22(31-3)8-5-20/h4-8,19,23,25-26H,9-18H2,1-3H3 |
| InChIKey | RQRQZJSMYSUZNY-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|