C26H23N3O3 — CID 129302274
3-(4-hydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one (PubChem CID 129302274) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-(4-hydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one.
| Compound Name | 3-(4-hydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
|---|---|
| PubChem CID | 129302274 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-(4-hydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
| SMILES | CC1CC(O)CC(n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)CNC4=O)O1 |
| InChI | InChI=1S/C26H23N3O3/c1-13-10-14(30)11-20(32-13)29-19-9-5-3-7-16(19)22-23-17(12-27-26(23)31)21-15-6-2-4-8-18(15)28-24(21)25(22)29/h2-9,13-14,20,28,30H,10-12H2,1H3,(H,27,31) |
| InChIKey | UTHMKOFIYFMPEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |