C26H23N3O4 — CID 74941433
3-(4,5-dihydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one (PubChem CID 74941433) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-(4,5-dihydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one.
| Compound Name | 3-(4,5-dihydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
|---|---|
| PubChem CID | 74941433 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-(4,5-dihydroxy-6-methyloxan-2-yl)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
| SMILES | CC1OC(n2c3ccccc3c3c4c(c5c6ccccc6[nH]c5c32)CNC4=O)CC(O)C1O |
| InChI | InChI=1S/C26H23N3O4/c1-12-25(31)18(30)10-19(33-12)29-17-9-5-3-7-14(17)21-22-15(11-27-26(22)32)20-13-6-2-4-8-16(13)28-23(20)24(21)29/h2-9,12,18-19,25,28,30-31H,10-11H2,1H3,(H,27,32) |
| InChIKey | MCPPOSAODOGSHG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |