C28H31F2N5O3 — CID 129308288
N-[amino-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]methylidene]-4-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 129308288) has the molecular formula C28H31F2N5O3 and a molecular weight of 523.58 g/mol. Its IUPAC name is N-[amino-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]methylidene]-4-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[amino-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]methylidene]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 129308288 |
| Molecular Formula | C28H31F2N5O3 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | N-[amino-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]methylidene]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | COc1cc(OC)c(F)c(-c2ccc(/C(N)=N/C(=O)c3ccc(CN4CCN(C)CC4)cc3)c(N)c2)c1F |
| InChI | InChI=1S/C28H31F2N5O3/c1-34-10-12-35(13-11-34)16-17-4-6-18(7-5-17)28(36)33-27(32)20-9-8-19(14-21(20)31)24-25(29)22(37-2)15-23(38-3)26(24)30/h4-9,14-15H,10-13,16,31H2,1-3H3,(H2,32,33,36) |
| InChIKey | YZGMLMNTYZMRPT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|