C28H33F2N5O3 — CID 145019713
2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)-N'-methylbenzenecarboximidamide;4-(4-methylpiperazin-1-yl)benzaldehyde (PubChem CID 145019713) has the molecular formula C28H33F2N5O3 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)-N'-methylbenzenecarboximidamide;4-(4-methylpiperazin-1-yl)benzaldehyde.
| Compound Name | 2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)-N'-methylbenzenecarboximidamide;4-(4-methylpiperazin-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 145019713 |
| Molecular Formula | C28H33F2N5O3 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)-N'-methylbenzenecarboximidamide;4-(4-methylpiperazin-1-yl)benzaldehyde |
| SMILES | C/N=C(\N)c1ccc(-c2c(F)c(OC)cc(OC)c2F)cc1N.CN1CCN(c2ccc(C=O)cc2)CC1 |
| InChI | InChI=1S/C16H17F2N3O2.C12H16N2O/c1-21-16(20)9-5-4-8(6-10(9)19)13-14(17)11(22-2)7-12(23-3)15(13)18;1-13-6-8-14(9-7-13)12-4-2-11(10-15)3-5-12/h4-7H,19H2,1-3H3,(H2,20,21);2-5,10H,6-9H2,1H3 |
| InChIKey | PIXNKYJBOLQKOS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|