C25H28Cl2N6O2 — CID 145192738
2-amino-4-(2,6-dichloro-3,5-dimethoxyphenyl)-N'-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzenecarboximidamide (PubChem CID 145192738) has the molecular formula C25H28Cl2N6O2 and a molecular weight of 515.45 g/mol. Its IUPAC name is 2-amino-4-(2,6-dichloro-3,5-dimethoxyphenyl)-N'-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzenecarboximidamide.
| Compound Name | 2-amino-4-(2,6-dichloro-3,5-dimethoxyphenyl)-N'-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145192738 |
| Molecular Formula | C25H28Cl2N6O2 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-amino-4-(2,6-dichloro-3,5-dimethoxyphenyl)-N'-[5-(4-methylpiperazin-1-yl)-2-pyridinyl]benzenecarboximidamide |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc(/C(N)=N/c3ccc(N4CCN(C)CC4)cn3)c(N)c2)c1Cl |
| InChI | InChI=1S/C25H28Cl2N6O2/c1-32-8-10-33(11-9-32)16-5-7-21(30-14-16)31-25(29)17-6-4-15(12-18(17)28)22-23(26)19(34-2)13-20(35-3)24(22)27/h4-7,12-14H,8-11,28H2,1-3H3,(H2,29,30,31) |
| InChIKey | BFKWCQIAGAYWBV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|