C27H27F2N5O3 — CID 145192711
6-(2,6-difluoro-3,5-dimethoxyphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 145192711) has the molecular formula C27H27F2N5O3 and a molecular weight of 507.54 g/mol. Its IUPAC name is 6-(2,6-difluoro-3,5-dimethoxyphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 145192711 |
| Molecular Formula | C27H27F2N5O3 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | COc1cc(OC)c(F)c(-c2ccc3c(C(=O)Nc4ccc(N5CCN(C)CC5)cc4)n[nH]c3c2)c1F |
| InChI | InChI=1S/C27H27F2N5O3/c1-33-10-12-34(13-11-33)18-7-5-17(6-8-18)30-27(35)26-19-9-4-16(14-20(19)31-32-26)23-24(28)21(36-2)15-22(37-3)25(23)29/h4-9,14-15H,10-13H2,1-3H3,(H,30,35)(H,31,32) |
| InChIKey | FEPRJUXWPZFSQB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|