C21H24N6O3S — CID 175258867
5-(ethenylsulfonylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 175258867) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 5-(ethenylsulfonylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-(ethenylsulfonylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 175258867 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-(ethenylsulfonylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | C=CS(=O)(=O)Nc1ccc2[nH]nc(C(=O)Nc3ccc(N4CCN(C)CC4)cc3)c2c1 |
| InChI | InChI=1S/C21H24N6O3S/c1-3-31(29,30)25-16-6-9-19-18(14-16)20(24-23-19)21(28)22-15-4-7-17(8-5-15)27-12-10-26(2)11-13-27/h3-9,14,25H,1,10-13H2,2H3,(H,22,28)(H,23,24) |
| InChIKey | ZBNBQDOPIRRCDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|