C22H24N6O2 — CID 175258855
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(prop-2-enoylamino)-1H-indazole-3-carboxamide (PubChem CID 175258855) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(prop-2-enoylamino)-1H-indazole-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(prop-2-enoylamino)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 175258855 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(prop-2-enoylamino)-1H-indazole-3-carboxamide |
| SMILES | C=CC(=O)Nc1cccc2[nH]nc(C(=O)Nc3ccc(N4CCN(C)CC4)cc3)c12 |
| InChI | InChI=1S/C22H24N6O2/c1-3-19(29)24-17-5-4-6-18-20(17)21(26-25-18)22(30)23-15-7-9-16(10-8-15)28-13-11-27(2)12-14-28/h3-10H,1,11-14H2,2H3,(H,23,30)(H,24,29)(H,25,26) |
| InChIKey | ABMSITUDFSFJCF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|