C26H27ClFN5O — CID 155432423
N-[2-[2-chloro-5-[4-(4-methylpiperazin-1-yl)anilino]anilino]-6-fluorophenyl]prop-2-enamide (PubChem CID 155432423) has the molecular formula C26H27ClFN5O and a molecular weight of 479.99 g/mol. Its IUPAC name is N-[2-[2-chloro-5-[4-(4-methylpiperazin-1-yl)anilino]anilino]-6-fluorophenyl]prop-2-enamide.
| Compound Name | N-[2-[2-chloro-5-[4-(4-methylpiperazin-1-yl)anilino]anilino]-6-fluorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155432423 |
| Molecular Formula | C26H27ClFN5O |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-[2-[2-chloro-5-[4-(4-methylpiperazin-1-yl)anilino]anilino]-6-fluorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(F)cccc1Nc1cc(Nc2ccc(N3CCN(C)CC3)cc2)ccc1Cl |
| InChI | InChI=1S/C26H27ClFN5O/c1-3-25(34)31-26-22(28)5-4-6-23(26)30-24-17-19(9-12-21(24)27)29-18-7-10-20(11-8-18)33-15-13-32(2)14-16-33/h3-12,17,29-30H,1,13-16H2,2H3,(H,31,34) |
| InChIKey | NMEOIJLQWCDLPH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|