C22H25ClN6O2 — CID 175374580
4-(3-chloropropanoylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide (PubChem CID 175374580) has the molecular formula C22H25ClN6O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is 4-(3-chloropropanoylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide.
| Compound Name | 4-(3-chloropropanoylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 175374580 |
| Molecular Formula | C22H25ClN6O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-(3-chloropropanoylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-indazole-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3n[nH]c4cccc(NC(=O)CCCl)c34)cc2)CC1 |
| InChI | InChI=1S/C22H25ClN6O2/c1-28-11-13-29(14-12-28)16-7-5-15(6-8-16)24-22(31)21-20-17(25-19(30)9-10-23)3-2-4-18(20)26-27-21/h2-8H,9-14H2,1H3,(H,24,31)(H,25,30)(H,26,27) |
| InChIKey | PGJPIZVPBGKKIM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|