C28H31F2N5O3 — CID 145192757
2-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-2-iminoacetamide (PubChem CID 145192757) has the molecular formula C28H31F2N5O3 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-2-iminoacetamide.
| Compound Name | 2-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-2-iminoacetamide |
|---|---|
| PubChem CID | 145192757 |
| Molecular Formula | C28H31F2N5O3 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-[2-amino-4-(2,6-difluoro-3,5-dimethoxyphenyl)phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)phenyl]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(N2CC(C)NC(C)C2)cc1)c1ccc(-c2c(F)c(OC)cc(OC)c2F)cc1N |
| InChI | InChI=1S/C28H31F2N5O3/c1-15-13-35(14-16(2)33-15)19-8-6-18(7-9-19)34-28(36)27(32)20-10-5-17(11-21(20)31)24-25(29)22(37-3)12-23(38-4)26(24)30/h5-12,15-16,32-33H,13-14,31H2,1-4H3,(H,34,36)/b32-27- |
| InChIKey | LGPBVMVHEOHOMV-MXNGAVTRSA-N |
| XLogP | 4.42 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|