C14H16BrNO2 — CID 129309464
methyl 6-(bromomethyl)-4-(3-methylpent-1-ynyl)pyridine-2-carboxylate (PubChem CID 129309464) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is methyl 6-(bromomethyl)-4-(3-methylpent-1-ynyl)pyridine-2-carboxylate.
| Compound Name | methyl 6-(bromomethyl)-4-(3-methylpent-1-ynyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129309464 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | methyl 6-(bromomethyl)-4-(3-methylpent-1-ynyl)pyridine-2-carboxylate |
| SMILES | CCC(C)C#Cc1cc(CBr)nc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H16BrNO2/c1-4-10(2)5-6-11-7-12(9-15)16-13(8-11)14(17)18-3/h7-8,10H,4,9H2,1-3H3 |
| InChIKey | QGCFLADJPBDRRA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|