C32H33NO3 — CID 167428424
methyl 6-(hydroxymethyl)-4-[2-[4-(10-phenyldec-1-ynyl)phenyl]ethynyl]pyridine-2-carboxylate (PubChem CID 167428424) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is methyl 6-(hydroxymethyl)-4-[2-[4-(10-phenyldec-1-ynyl)phenyl]ethynyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-(hydroxymethyl)-4-[2-[4-(10-phenyldec-1-ynyl)phenyl]ethynyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 167428424 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | methyl 6-(hydroxymethyl)-4-[2-[4-(10-phenyldec-1-ynyl)phenyl]ethynyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(C#Cc2ccc(C#CCCCCCCCCc3ccccc3)cc2)cc(CO)n1 |
| InChI | InChI=1S/C32H33NO3/c1-36-32(35)31-24-29(23-30(25-34)33-31)22-21-28-19-17-27(18-20-28)16-10-7-5-3-2-4-6-9-13-26-14-11-8-12-15-26/h8,11-12,14-15,17-20,23-24,34H,2-7,9,13,25H2,1H3 |
| InChIKey | JVMLADSNKLXYKW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|