C19H21NO4 — CID 144670022
ethane;methyl 6-(hydroxymethyl)-4-[2-(4-methoxyphenyl)ethynyl]pyridine-2-carboxylate (PubChem CID 144670022) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethane;methyl 6-(hydroxymethyl)-4-[2-(4-methoxyphenyl)ethynyl]pyridine-2-carboxylate.
| Compound Name | ethane;methyl 6-(hydroxymethyl)-4-[2-(4-methoxyphenyl)ethynyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 144670022 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | ethane;methyl 6-(hydroxymethyl)-4-[2-(4-methoxyphenyl)ethynyl]pyridine-2-carboxylate |
| SMILES | CC.COC(=O)c1cc(C#Cc2ccc(OC)cc2)cc(CO)n1 |
| InChI | InChI=1S/C17H15NO4.C2H6/c1-21-15-7-5-12(6-8-15)3-4-13-9-14(11-19)18-16(10-13)17(20)22-2;1-2/h5-10,19H,11H2,1-2H3;1-2H3 |
| InChIKey | VENVTMLZXOOOCE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|