C11H11NO3 — CID 134350178
methyl 6-(hydroxymethyl)-4-prop-1-ynylpyridine-2-carboxylate (PubChem CID 134350178) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl 6-(hydroxymethyl)-4-prop-1-ynylpyridine-2-carboxylate.
| Compound Name | methyl 6-(hydroxymethyl)-4-prop-1-ynylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 134350178 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl 6-(hydroxymethyl)-4-prop-1-ynylpyridine-2-carboxylate |
| SMILES | CC#Cc1cc(CO)nc(C(=O)OC)c1 |
| InChI | InChI=1S/C11H11NO3/c1-3-4-8-5-9(7-13)12-10(6-8)11(14)15-2/h5-6,13H,7H2,1-2H3 |
| InChIKey | OJKQBGLFHZXEGX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|