C16H32O — CID 129310475
(Z)-5-tert-butyl-6-ethyl-7,7-dimethyloct-5-en-2-ol (PubChem CID 129310475) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is (Z)-5-tert-butyl-6-ethyl-7,7-dimethyloct-5-en-2-ol.
| Compound Name | (Z)-5-tert-butyl-6-ethyl-7,7-dimethyloct-5-en-2-ol |
|---|---|
| PubChem CID | 129310475 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | (Z)-5-tert-butyl-6-ethyl-7,7-dimethyloct-5-en-2-ol |
| SMILES | CC/C(=C(\CCC(C)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O/c1-9-13(15(3,4)5)14(16(6,7)8)11-10-12(2)17/h12,17H,9-11H2,1-8H3/b14-13- |
| InChIKey | AEMVDEWBCOAIGU-YPKPFQOOSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|