C30H44O4 — CID 129316535
6-[(3aS,6S,7R,9bS)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoic acid (PubChem CID 129316535) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 6-[(3aS,6S,7R,9bS)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoic acid.
| Compound Name | 6-[(3aS,6S,7R,9bS)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 129316535 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 6-[(3aS,6S,7R,9bS)-6-(2-carboxyethyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoic acid |
| SMILES | C=C(C)[C@H]1CCC2C(=CC[C@]3(C)C(=C(C)CCC=C(C)C(=O)O)CC[C@@]23C)[C@@]1(C)CCC(=O)O |
| InChI | InChI=1S/C30H44O4/c1-19(2)22-11-12-25-24(28(22,5)16-15-26(31)32)14-18-29(6)23(13-17-30(25,29)7)20(3)9-8-10-21(4)27(33)34/h10,14,22,25H,1,8-9,11-13,15-18H2,2-7H3,(H,31,32)(H,33,34)/t22-,25?,28+,29-,30+/m1/s1 |
| InChIKey | QOIBKZDJHBYYMX-WMOWHGPUSA-N |
| XLogP | 7.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|