C32H48O4 — CID 46174605
methyl (Z,6Z)-6-[(3aS,6S,7S,9aS,9bS)-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoate (PubChem CID 46174605) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is methyl (Z,6Z)-6-[(3aS,6S,7S,9aS,9bS)-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoate.
| Compound Name | methyl (Z,6Z)-6-[(3aS,6S,7S,9aS,9bS)-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoate |
|---|---|
| PubChem CID | 46174605 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | methyl (Z,6Z)-6-[(3aS,6S,7S,9aS,9bS)-6-(3-methoxy-3-oxopropyl)-3a,6,9b-trimethyl-7-prop-1-en-2-yl-2,4,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-ylidene]-2-methylhept-2-enoate |
| SMILES | C=C(C)[C@@H]1CC[C@@H]2C(=CC[C@]3(C)/C(=C(/C)CC/C=C(/C)C(=O)OC)CC[C@@]23C)[C@@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C32H48O4/c1-21(2)24-13-14-27-26(30(24,5)18-17-28(33)35-8)16-20-31(6)25(15-19-32(27,31)7)22(3)11-10-12-23(4)29(34)36-9/h12,16,24,27H,1,10-11,13-15,17-20H2,2-9H3/b23-12-,25-22-/t24-,27+,30-,31+,32-/m0/s1 |
| InChIKey | JEMQZWVNSVUVCN-QVOAVYIXSA-N |
| XLogP | 7.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|