C13H13FN3O4P — CID 129317926
4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid (PubChem CID 129317926) has the molecular formula C13H13FN3O4P and a molecular weight of 325.24 g/mol. Its IUPAC name is 4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid.
| Compound Name | 4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid |
|---|---|
| PubChem CID | 129317926 |
| Molecular Formula | C13H13FN3O4P |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 4-[(5S)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-5-yl]-3-fluorobenzonitrile;phosphoric acid |
| SMILES | N#Cc1ccc([C@@H]2CCc3cncn32)c(F)c1.O=P(O)(O)O |
| InChI | InChI=1S/C13H10FN3.H3O4P/c14-12-5-9(6-15)1-3-11(12)13-4-2-10-7-16-8-17(10)13;1-5(2,3)4/h1,3,5,7-8,13H,2,4H2;(H3,1,2,3,4)/t13-;/m0./s1 |
| InChIKey | FMCPYRDGUZBOJZ-ZOWNYOTGSA-N |
| XLogP | 1.50 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|