C6H3ClN6O2 — CID 129319403
4-chloro-6-(3-nitro-1,2,4-triazol-1-yl)pyrimidine (PubChem CID 129319403) has the molecular formula C6H3ClN6O2 and a molecular weight of 226.58 g/mol. Its IUPAC name is 4-chloro-6-(3-nitro-1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 4-chloro-6-(3-nitro-1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 129319403 |
| Molecular Formula | C6H3ClN6O2 |
| Molecular Weight | 226.58 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 4-chloro-6-(3-nitro-1,2,4-triazol-1-yl)pyrimidine |
| SMILES | O=[N+]([O-])c1ncn(-c2cc(Cl)ncn2)n1 |
| InChI | InChI=1S/C6H3ClN6O2/c7-4-1-5(9-2-8-4)12-3-10-6(11-12)13(14)15/h1-3H |
| InChIKey | RIHSZRXKLOKQNX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.58 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|