C12H11F3N2O3 — CID 129320176
methyl 3-[6-hydroxy-2-(trifluoromethyl)benzimidazol-1-yl]propanoate (PubChem CID 129320176) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. Its IUPAC name is methyl 3-[6-hydroxy-2-(trifluoromethyl)benzimidazol-1-yl]propanoate.
| Compound Name | methyl 3-[6-hydroxy-2-(trifluoromethyl)benzimidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 129320176 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 3-[6-hydroxy-2-(trifluoromethyl)benzimidazol-1-yl]propanoate |
| SMILES | COC(=O)CCn1c(C(F)(F)F)nc2ccc(O)cc21 |
| InChI | InChI=1S/C12H11F3N2O3/c1-20-10(19)4-5-17-9-6-7(18)2-3-8(9)16-11(17)12(13,14)15/h2-3,6,18H,4-5H2,1H3 |
| InChIKey | OLUDSFUPJXRBTB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |