C11H18N2O2 — CID 129322675
(3S)-3-[[(2S,3S)-2-cyclopropyloxolan-3-yl]amino]pyrrolidin-2-one (PubChem CID 129322675) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (3S)-3-[[(2S,3S)-2-cyclopropyloxolan-3-yl]amino]pyrrolidin-2-one.
| Compound Name | (3S)-3-[[(2S,3S)-2-cyclopropyloxolan-3-yl]amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129322675 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3S)-3-[[(2S,3S)-2-cyclopropyloxolan-3-yl]amino]pyrrolidin-2-one |
| SMILES | O=C1NCC[C@@H]1N[C@H]1CCO[C@H]1C1CC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11-9(3-5-12-11)13-8-4-6-15-10(8)7-1-2-7/h7-10,13H,1-6H2,(H,12,14)/t8-,9-,10-/m0/s1 |
| InChIKey | FWFCASKWTCPRLP-GUBZILKMSA-N |
| XLogP | 0.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |