C13H20N2O2S — CID 129324249
2-[[(3S)-3-methyl-1-(2-thiophen-2-ylethyl)pyrrolidin-3-yl]amino]acetic acid (PubChem CID 129324249) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[[(3S)-3-methyl-1-(2-thiophen-2-ylethyl)pyrrolidin-3-yl]amino]acetic acid.
| Compound Name | 2-[[(3S)-3-methyl-1-(2-thiophen-2-ylethyl)pyrrolidin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 129324249 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[[(3S)-3-methyl-1-(2-thiophen-2-ylethyl)pyrrolidin-3-yl]amino]acetic acid |
| SMILES | C[C@]1(NCC(=O)O)CCN(CCc2cccs2)C1 |
| InChI | InChI=1S/C13H20N2O2S/c1-13(14-9-12(16)17)5-7-15(10-13)6-4-11-3-2-8-18-11/h2-3,8,14H,4-7,9-10H2,1H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | KMFJIEHOYDGIPG-ZDUSSCGKSA-N |
| XLogP | 1.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |