C19H25N5O4 — CID 129324321
5-[(3R)-1-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]piperidin-3-yl]-N,N-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 129324321) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[(3R)-1-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]piperidin-3-yl]-N,N-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3R)-1-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]piperidin-3-yl]-N,N-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129324321 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-[(3R)-1-[(2R)-2-hydroxy-2-(3-nitrophenyl)ethyl]piperidin-3-yl]-N,N-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1cn[nH]c1[C@@H]1CCCN(C[C@H](O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C19H25N5O4/c1-22(2)19(26)16-10-20-21-18(16)14-6-4-8-23(11-14)12-17(25)13-5-3-7-15(9-13)24(27)28/h3,5,7,9-10,14,17,25H,4,6,8,11-12H2,1-2H3,(H,20,21)/t14-,17+/m1/s1 |
| InChIKey | LOPTXYIETJBFEL-PBHICJAKSA-N |
| XLogP | 1.93 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|