C16H20N4O4 — CID 84591052
2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-1-(3-nitrophenyl)ethanol (PubChem CID 84591052) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-1-(3-nitrophenyl)ethanol.
| Compound Name | 2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-1-(3-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 84591052 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]-1-(3-nitrophenyl)ethanol |
| SMILES | Cc1nc(C2CCN(CC(O)c3cccc([N+](=O)[O-])c3)CC2)no1 |
| InChI | InChI=1S/C16H20N4O4/c1-11-17-16(18-24-11)12-5-7-19(8-6-12)10-15(21)13-3-2-4-14(9-13)20(22)23/h2-4,9,12,15,21H,5-8,10H2,1H3 |
| InChIKey | BOPNBEXWSXLNKX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|