About 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one
3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 129331540) has the molecular formula C18H18F2N6O
and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
| PubChem CID | 129331540 |
| Molecular Formula | C18H18F2N6O |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC[C@@H](Nc3ncnc4cc(F)c(F)cc34)C2)c1=O |
| InChI | InChI=1S/C18H18F2N6O/c1-25-6-4-21-17(18(25)27)26-5-2-3-11(9-26)24-16-12-7-13(19)14(20)8-15(12)22-10-23-16/h4,6-8,10-11H,2-3,5,9H2,1H3,(H,22,23,24)/t11-/m1/s1 |
| InChIKey | JODYVUISRIEHGY-LLVKDONJSA-N |
| XLogP | 2.08 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one?
The IUPAC name of 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one (CID 129331540) is 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one.
What is the SMILES notation for 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one?
The canonical SMILES for 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one is Cn1ccnc(N2CCC[C@@H](Nc3ncnc4cc(F)c(F)cc34)C2)c1=O.
What is the InChIKey of 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one?
The InChIKey is JODYVUISRIEHGY-LLVKDONJSA-N. The full InChI is InChI=1S/C18H18F2N6O/c1-25-6-4-21-17(18(25)27)26-5-2-3-11(9-26)24-16-12-7-13(19)14(20)8-15(12)22-10-23-16/h4,6-8,10-11H,2-3,5,9H2,1H3,(H,22,23,24)/t11-/m1/s1.
What are the key properties of 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one?
3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one has a molecular weight of 372.38 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-3-[(6,7-difluoroquinazolin-4-yl)amino]piperidin-1-yl]-1-methylpyrazin-2-one is sourced from PubChem (CID 129331540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).