C18H23N5O2 — CID 129339675
1-[2-[(4R)-4-[(6-amino-3-pyridinyl)amino]azepan-1-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 129339675) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-[2-[(4R)-4-[(6-amino-3-pyridinyl)amino]azepan-1-yl]-2-oxoethyl]pyridin-2-one.
| Compound Name | 1-[2-[(4R)-4-[(6-amino-3-pyridinyl)amino]azepan-1-yl]-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 129339675 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[2-[(4R)-4-[(6-amino-3-pyridinyl)amino]azepan-1-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | Nc1ccc(N[C@@H]2CCCN(C(=O)Cn3ccccc3=O)CC2)cn1 |
| InChI | InChI=1S/C18H23N5O2/c19-16-7-6-15(12-20-16)21-14-4-3-10-22(11-8-14)18(25)13-23-9-2-1-5-17(23)24/h1-2,5-7,9,12,14,21H,3-4,8,10-11,13H2,(H2,19,20)/t14-/m1/s1 |
| InChIKey | OXYCJUYTKGVNRN-CQSZACIVSA-N |
| XLogP | 1.32 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |