C10H16 — CID 12935668
2-methylidenebicyclo[3.3.1]nonane (PubChem CID 12935668) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 2-methylidenebicyclo[3.3.1]nonane.
| Compound Name | 2-methylidenebicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 12935668 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 2-methylidenebicyclo[3.3.1]nonane |
| SMILES | C=C1CCC2CCCC1C2 |
| InChI | InChI=1S/C10H16/c1-8-5-6-9-3-2-4-10(8)7-9/h9-10H,1-7H2 |
| InChIKey | WYSYRGOYGZBCLG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|