C9H12O2 — CID 131857123
(1S,5R)-6-methylidene-2-oxabicyclo[3.3.1]nonan-3-one (PubChem CID 131857123) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,5R)-6-methylidene-2-oxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1S,5R)-6-methylidene-2-oxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 131857123 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,5R)-6-methylidene-2-oxabicyclo[3.3.1]nonan-3-one |
| SMILES | C=C1CC[C@H]2C[C@@H]1CC(=O)O2 |
| InChI | InChI=1S/C9H12O2/c1-6-2-3-8-4-7(6)5-9(10)11-8/h7-8H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | DTQBZLSYHXVFIG-SFYZADRCSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|