C9H12O7S2 — CID 129359835
(1S,3R)-1-hydroxy-3-phenylpropane-1,3-disulfonic acid (PubChem CID 129359835) has the molecular formula C9H12O7S2 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1S,3R)-1-hydroxy-3-phenylpropane-1,3-disulfonic acid.
| Compound Name | (1S,3R)-1-hydroxy-3-phenylpropane-1,3-disulfonic acid |
|---|---|
| PubChem CID | 129359835 |
| Molecular Formula | C9H12O7S2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (1S,3R)-1-hydroxy-3-phenylpropane-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)[C@H](O)C[C@H](c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C9H12O7S2/c10-9(18(14,15)16)6-8(17(11,12)13)7-4-2-1-3-5-7/h1-5,8-10H,6H2,(H,11,12,13)(H,14,15,16)/t8-,9+/m1/s1 |
| InChIKey | DGPQHOUOLKPORQ-BDAKNGLRSA-N |
| XLogP | 0.21 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|