C9H12Na2O7S2 — CID 131865305
CID 131865305 (PubChem CID 131865305) has the molecular formula C9H12Na2O7S2 and a molecular weight of 342.30 g/mol.
| Compound Name | CID 131865305 |
|---|---|
| PubChem CID | 131865305 |
| Molecular Formula | C9H12Na2O7S2 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(O)CC(c1ccccc1)S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C9H12O7S2.2Na/c10-9(18(14,15)16)6-8(17(11,12)13)7-4-2-1-3-5-7;;/h1-5,8-10H,6H2,(H,11,12,13)(H,14,15,16);; |
| InChIKey | KNMGEMVGJHRINX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|