C7H9NaO6S2 — CID 174651306
sodium;hydride;phenylmethanedisulfonic acid (PubChem CID 174651306) has the molecular formula C7H9NaO6S2 and a molecular weight of 276.27 g/mol. Its IUPAC name is sodium;hydride;phenylmethanedisulfonic acid.
| Compound Name | sodium;hydride;phenylmethanedisulfonic acid |
|---|---|
| PubChem CID | 174651306 |
| Molecular Formula | C7H9NaO6S2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | sodium;hydride;phenylmethanedisulfonic acid |
| SMILES | O=S(=O)(O)C(c1ccccc1)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H8O6S2.Na.H/c8-14(9,10)7(15(11,12)13)6-4-2-1-3-5-6;;/h1-5,7H,(H,8,9,10)(H,11,12,13);;/q;+1;-1 |
| InChIKey | RXNJGQVWQVKVDO-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|